Products 163630-89-5

CAS 163630-89-5 is the registry number for Paroxetine Impurity 56. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-benzyl-4-(4-fluorophenyl)-3,6-dihydro-2H-pyridine (CAS 163630-89-5) is a chemical compound with the molecular formula C18H18FN and a molecular weight of 267.3 g/mol. IUPAC name: 1-benzyl-4-(4-fluorophenyl)-3,6-dihydro-2H-pyridine. InChIKey: LLRJZCQEHKIWCO-UHFFFAOYSA-N.

Identity
Molecular formulaC18H18FN
Molecular weight267.3 g/mol
IUPAC name1-benzyl-4-(4-fluorophenyl)-3,6-dihydro-2H-pyridine
InChIKeyLLRJZCQEHKIWCO-UHFFFAOYSA-N
SMILESC1CN(CC=C1C2=CC=C(C=C2)F)CC3=CC=CC=C3

Computed by PubChem (NCBI)