CAS 163659-65-2 is the registry number for beta-D-Glucopyranuronosylamine. Offered by: TRC. Available pack sizes: 500mg.
(2S,3S,4S,5R,6R)-6-amino-3,4,5-trihydroxyoxane-2-carboxylic acid (CAS 163659-65-2) is a chemical compound with the molecular formula C6H11NO6 and a molecular weight of 193.15 g/mol. IUPAC name: (2S,3S,4S,5R,6R)-6-amino-3,4,5-trihydroxyoxane-2-carboxylic acid. InChIKey: GUBZNLBDQBXDQM-CIOUUCGESA-N.
| Molecular formula | C6H11NO6 |
|---|---|
| Molecular weight | 193.15 g/mol |
| IUPAC name | (2S,3S,4S,5R,6R)-6-amino-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | GUBZNLBDQBXDQM-CIOUUCGESA-N |
| SMILES | [C@@H]1([C@@H]([C@H](O[C@H]([C@@H]1O)N)C(=O)O)O)O |
Computed by PubChem (NCBI)