Products 163714-64-5

CAS 163714-64-5 is the registry number for 1,3-Diethyl 2-(4,4,4-trifluorobutanoyl)propanedioate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Diethyl 2-(4,4,4-trifluorobutanoyl)propanedioate (CAS 163714-64-5) is a chemical compound with the molecular formula C11H15F3O5 and a molecular weight of 284.23 g/mol. IUPAC name: diethyl 2-(4,4,4-trifluorobutanoyl)propanedioate. InChIKey: KEIJZNNFFCFTKM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15F3O5
Molecular weight284.23 g/mol
IUPAC namediethyl 2-(4,4,4-trifluorobutanoyl)propanedioate
InChIKeyKEIJZNNFFCFTKM-UHFFFAOYSA-N
SMILESCCOC(=O)C(C(=O)CCC(F)(F)F)C(=O)OCC

Computed by PubChem (NCBI)