CAS 1637223-09-6 is the registry number for Vilazodone Impurity 17. Offered by: Chemat Brand. Available pack sizes: on request.
5-[4-[4-(5-cyano-1H-indol-3-yl)-4-oxobutyl]piperazin-1-yl]-1-benzofuran-2-carboxamide (CAS 1637223-09-6) is a chemical compound with the molecular formula C26H25N5O3 and a molecular weight of 455.5 g/mol. IUPAC name: 5-[4-[4-(5-cyano-1H-indol-3-yl)-4-oxobutyl]piperazin-1-yl]-1-benzofuran-2-carboxamide. InChIKey: BMSCRDJVFQWRDR-UHFFFAOYSA-N.
| Molecular formula | C26H25N5O3 |
|---|---|
| Molecular weight | 455.5 g/mol |
| IUPAC name | 5-[4-[4-(5-cyano-1H-indol-3-yl)-4-oxobutyl]piperazin-1-yl]-1-benzofuran-2-carboxamide |
| InChIKey | BMSCRDJVFQWRDR-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCCC(=O)C2=CNC3=C2C=C(C=C3)C#N)C4=CC5=C(C=C4)OC(=C5)C(=O)N |
Computed by PubChem (NCBI)