CAS 163734-06-3 appears in our catalog under these names: 3-(2-Amino-6-oxo-1,6-dihydro-7H-purin-7-yl)-2-hydroxypropanamide, 97%, N7-(2-Carbamoyl-2-hydroxyethyl)guanine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg, 5mg.
3-(2-amino-6-oxo-1H-purin-7-yl)-2-hydroxypropanamide (CAS 163734-06-3) is a chemical compound with the molecular formula C8H10N6O3 and a molecular weight of 238.20 g/mol. IUPAC name: 3-(2-amino-6-oxo-1H-purin-7-yl)-2-hydroxypropanamide. InChIKey: JYHHZNJOFXOGSQ-UHFFFAOYSA-N.
| Molecular formula | C8H10N6O3 |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | 3-(2-amino-6-oxo-1H-purin-7-yl)-2-hydroxypropanamide |
| InChIKey | JYHHZNJOFXOGSQ-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1CC(C(=O)N)O)C(=O)NC(=N2)N |
Computed by PubChem (NCBI)