Products 1637371-67-5
CAS 1637371-67-5 is the registry number for (R)–5–(2–Carboxypyrrolidine–1–carbonyl)isophthalic acid. Offered by: GLPBio. Available pack sizes: 1g.
5-[(2R)-2-carboxypyrrolidine-1-carbonyl]benzene-1,3-dicarboxylic acid (CAS 1637371-67-5) is a chemical compound with the molecular formula C14H13NO7 and a molecular weight of 307.25 g/mol. IUPAC name: 5-[(2R)-2-carboxypyrrolidine-1-carbonyl]benzene-1,3-dicarboxylic acid. InChIKey: SVEIWRCKSZENKQ-SNVBAGLBSA-N.
| Molecular formula | C14H13NO7 |
|---|---|
| Molecular weight | 307.25 g/mol |
| IUPAC name | 5-[(2R)-2-carboxypyrrolidine-1-carbonyl]benzene-1,3-dicarboxylic acid |
| InChIKey | SVEIWRCKSZENKQ-SNVBAGLBSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)C2=CC(=CC(=C2)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)