CAS 1637430-81-9 is the registry number for (1S,4S)-7-Fluoro-2-oxa-5-azabicyclo[2.2.1]heptane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,4S)-7-fluoro-2-oxa-5-azabicyclo[2.2.1]heptane (CAS 1637430-81-9) is a chemical compound with the molecular formula C5H8FNO and a molecular weight of 117.12 g/mol. IUPAC name: (1S,4S)-7-fluoro-2-oxa-5-azabicyclo[2.2.1]heptane. InChIKey: LRQRLXHZCIJEOH-QRHDOFTISA-N.
| Molecular formula | C5H8FNO |
|---|---|
| Molecular weight | 117.12 g/mol |
| IUPAC name | (1S,4S)-7-fluoro-2-oxa-5-azabicyclo[2.2.1]heptane |
| InChIKey | LRQRLXHZCIJEOH-QRHDOFTISA-N |
| SMILES | C1[C@H]2C([C@@H](N1)CO2)F |
Computed by PubChem (NCBI)