CAS 1637453-47-4 is the registry number for 6-Cyclopropyl-4-fluoro-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-cyclopropyl-4-fluoro-2,3-dihydroinden-1-one (CAS 1637453-47-4) is a chemical compound with the molecular formula C12H11FO and a molecular weight of 190.21 g/mol. IUPAC name: 6-cyclopropyl-4-fluoro-2,3-dihydroinden-1-one. InChIKey: KOGWYGVGPXOBCV-UHFFFAOYSA-N.
| Molecular formula | C12H11FO |
|---|---|
| Molecular weight | 190.21 g/mol |
| IUPAC name | 6-cyclopropyl-4-fluoro-2,3-dihydroinden-1-one |
| InChIKey | KOGWYGVGPXOBCV-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC3=C(CCC3=O)C(=C2)F |
Computed by PubChem (NCBI)