CAS 1637540-47-6 is the registry number for (R)-4,6-Difluoro-2,3-dihydro-1H-inden-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-4,6-difluoro-2,3-dihydro-1H-inden-1-amine (CAS 1637540-47-6) is a chemical compound with the molecular formula C9H9F2N and a molecular weight of 169.17 g/mol. IUPAC name: (1R)-4,6-difluoro-2,3-dihydro-1H-inden-1-amine. InChIKey: PMEWWUGTAKIVBC-SECBINFHSA-N.
| Molecular formula | C9H9F2N |
|---|---|
| Molecular weight | 169.17 g/mol |
| IUPAC name | (1R)-4,6-difluoro-2,3-dihydro-1H-inden-1-amine |
| InChIKey | PMEWWUGTAKIVBC-SECBINFHSA-N |
| SMILES | C1CC2=C([C@@H]1N)C=C(C=C2F)F |
Computed by PubChem (NCBI)