CAS 1637542-33-6 appears in our catalog under these names: Nedisertib (M3814), Nedisertib, 98%, Nedisertib 98%, Nedisertib, 99.70%, Nedisertib (GMP). Offered by: Chemat Brand, AmBeed, MedChemExpress. Available pack sizes: on request, 5mg, 1g, 10mg, 25mg, 50mg, 100mg, 250mg.
(S)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol (CAS 1637542-33-6) is a chemical compound with the molecular formula C24H21ClFN5O3 and a molecular weight of 481.9 g/mol. IUPAC name: (S)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol. InChIKey: MOWXJLUYGFNTAL-DEOSSOPVSA-N.
| Molecular formula | C24H21ClFN5O3 |
|---|---|
| Molecular weight | 481.9 g/mol |
| IUPAC name | (S)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol |
| InChIKey | MOWXJLUYGFNTAL-DEOSSOPVSA-N |
| SMILES | COC1=NN=C(C=C1)[C@H](C2=C(C=C(C(=C2)C3=NC=NC4=C3C=CC(=C4)N5CCOCC5)F)Cl)O |
Computed by PubChem (NCBI)