CAS 1637547-42-2 is the registry number for 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isobenzofuran-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-benzofuran-1,3-dione (CAS 1637547-42-2) is a chemical compound with the molecular formula C14H15BO5 and a molecular weight of 274.08 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-benzofuran-1,3-dione. InChIKey: NGVWPAHQYGYZJV-UHFFFAOYSA-N.
| Molecular formula | C14H15BO5 |
|---|---|
| Molecular weight | 274.08 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-benzofuran-1,3-dione |
| InChIKey | NGVWPAHQYGYZJV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)C(=O)OC3=O |
Computed by PubChem (NCBI)