Products 16377-00-7
CAS 16377-00-7 is the registry number for Indospicine. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 0,5g, 1g, 10g.
L-indospicine is an alpha-amino acid that is 2,7-diaminoheptanoic acid substituted by a imino group at position 7 (the 2S stereoisomer). It has a role as a hepatotoxic agent and a plant metabolite. It is a carboxamidine and a non-proteinogenic L-alpha-amino acid.
Source: ChEBI
| Molecular formula | C7H15N3O2 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | (2S)-2,7-diamino-7-iminoheptanoic acid |
| InChIKey | SILQDLDAWPQMEL-YFKPBYRVSA-N |
| SMILES | C(CCC(=N)N)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
Indospicine, (2S)-2,7-diamino-7-iminoheptanoic acid, 6-Amidino-2-aminohexanoic acid, (2S)-2,7-diamino-7-imino-heptanoic acid, L-Indospicine, l-6-amidinonorleucine, (2S)-2-amino-6-carbamimidoylhexanoic acid, INDOSPICINE [MI], Heptanoic acid, 2,7-diamino-7-imino-, (S)-, L-.ALPHA.-AMINO-.EPSILON.-AMIDINOCAPROIC ACID