CAS 1637773-61-5 is the registry number for 2–Cyclopropyl–5–(3,5–dimethyl–4–isoxazolyl)–7–iodo–1H–benzimidazole. Offered by: GLPBio. Available pack sizes: 250mg, 50mg.
4-(2-cyclopropyl-7-iodo-3H-benzimidazol-5-yl)-3,5-dimethyl-1,2-oxazole (CAS 1637773-61-5) is a chemical compound with the molecular formula C15H14IN3O and a molecular weight of 379.20 g/mol. IUPAC name: 4-(2-cyclopropyl-7-iodo-3H-benzimidazol-5-yl)-3,5-dimethyl-1,2-oxazole. InChIKey: NFZLOQMJLFTTGM-UHFFFAOYSA-N.
| Molecular formula | C15H14IN3O |
|---|---|
| Molecular weight | 379.20 g/mol |
| IUPAC name | 4-(2-cyclopropyl-7-iodo-3H-benzimidazol-5-yl)-3,5-dimethyl-1,2-oxazole |
| InChIKey | NFZLOQMJLFTTGM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=CC3=C(C(=C2)I)N=C(N3)C4CC4 |
Computed by PubChem (NCBI)