Products 1637774-84-5

CAS 1637774-84-5 is the registry number for 6-Amino-3-bromo-2-fluorobenzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

6-amino-3-bromo-2-fluorobenzoic acid;hydrochloride (CAS 1637774-84-5) is a chemical compound with the molecular formula C7H6BrClFNO2 and a molecular weight of 270.48 g/mol. IUPAC name: 6-amino-3-bromo-2-fluorobenzoic acid;hydrochloride. InChIKey: JGFMHMTUPPGBQU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6BrClFNO2
Molecular weight270.48 g/mol
IUPAC name6-amino-3-bromo-2-fluorobenzoic acid;hydrochloride
InChIKeyJGFMHMTUPPGBQU-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1N)C(=O)O)F)Br.Cl

Computed by PubChem (NCBI)