Products 1638115-76-0
CAS 1638115-76-0 is the registry number for (1S,5S,6S)-6-Ethoxy-8-oxabicyclo[3.2.1]oct-3-en-2-one, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1S,5S,6S)-6-ethoxy-8-oxabicyclo[3.2.1]oct-3-en-2-one (CAS 1638115-76-0) is a chemical compound with the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. IUPAC name: (1S,5S,6S)-6-ethoxy-8-oxabicyclo[3.2.1]oct-3-en-2-one. InChIKey: CUWSWPRAIJBOOA-CIUDSAMLSA-N.
| Molecular formula | C9H12O3 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | (1S,5S,6S)-6-ethoxy-8-oxabicyclo[3.2.1]oct-3-en-2-one |
| InChIKey | CUWSWPRAIJBOOA-CIUDSAMLSA-N |
| SMILES | CCO[C@H]1C[C@H]2C(=O)C=C[C@@H]1O2 |
Computed by PubChem (NCBI)