CAS 16385-59-4 appears in our catalog under these names: Tetrabutylammonium perrhenate, 95%, Tetrabutylammonium perrhenate, Tetrabutylammonium Perrhenate, >98.0%(T), TETRABUTYLAMMONIUM PERRHENATE, 98%, Tetrabutylammonium perrhenate, 98.0%. Offered by: Combi-blocks, GLPBio, TCI, Sigma-Aldrich, MedChemExpress. Available pack sizes: 10g, 1g, 5g, 100 mg, 250 mg, 1 g.
Oxido(trioxo)rhenium;tetrabutylazanium (CAS 16385-59-4) is a chemical compound with the molecular formula C16H36NO4Re and a molecular weight of 492.67 g/mol. IUPAC name: oxido(trioxo)rhenium;tetrabutylazanium. InChIKey: MTTXKKTWRLXAKW-UHFFFAOYSA-N.
| Molecular formula | C16H36NO4Re |
|---|---|
| Molecular weight | 492.67 g/mol |
| IUPAC name | oxido(trioxo)rhenium;tetrabutylazanium |
| InChIKey | MTTXKKTWRLXAKW-UHFFFAOYSA-N |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.[O-][Re](=O)(=O)=O |
Computed by PubChem (NCBI)