Products 1638526-21-2
CAS 1638526-21-2 appears in our catalog under these names: EMT inhibitor-1/ 99%, EMT inhibitor–1, EMT inhibitor-1, 4-((4-(3,4-Dichlorophenyl)-1,2,5-thiadiazol-3-yl)oxy)butan-1-ol, 99%, 99%, EMT inhibitor-1, 99.82%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
4-[[4-(3,4-dichlorophenyl)-1,2,5-thiadiazol-3-yl]oxy]butan-1-ol (CAS 1638526-21-2) is a chemical compound with the molecular formula C12H12Cl2N2O2S and a molecular weight of 319.2 g/mol. IUPAC name: 4-[[4-(3,4-dichlorophenyl)-1,2,5-thiadiazol-3-yl]oxy]butan-1-ol. InChIKey: FWMUIOJZHOPPDX-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2N2O2S |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | 4-[[4-(3,4-dichlorophenyl)-1,2,5-thiadiazol-3-yl]oxy]butan-1-ol |
| InChIKey | FWMUIOJZHOPPDX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NSN=C2OCCCCO)Cl)Cl |
Computed by PubChem (NCBI)