CAS 163853-10-9 appears in our catalog under these names: BCAT, BCAT, Benzotriazole-1-carboxamidinium tosylate, BCAT 95%, BCAT, 97%, 97%, BCAT, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 100mg.
Benzotriazole-1-carboximidamide;4-methylbenzenesulfonic acid (CAS 163853-10-9) is a chemical compound with the molecular formula C14H15N5O3S and a molecular weight of 333.37 g/mol. IUPAC name: benzotriazole-1-carboximidamide;4-methylbenzenesulfonic acid. InChIKey: AZPBDRUPTRGILK-UHFFFAOYSA-N.
| Molecular formula | C14H15N5O3S |
|---|---|
| Molecular weight | 333.37 g/mol |
| IUPAC name | benzotriazole-1-carboximidamide;4-methylbenzenesulfonic acid |
| InChIKey | AZPBDRUPTRGILK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1=CC=C2C(=C1)N=NN2C(=N)N |
Computed by PubChem (NCBI)