CAS 1638587-20-8 is the registry number for Sodium (R)-1-methoxypropane-2-sulfinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium (2R)-1-methoxypropane-2-sulfinate (CAS 1638587-20-8) is a chemical compound with the molecular formula C4H9NaO3S and a molecular weight of 160.17 g/mol. IUPAC name: sodium (2R)-1-methoxypropane-2-sulfinate. InChIKey: VYVNYWFMSBNESQ-PGMHMLKASA-M.
| Molecular formula | C4H9NaO3S |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | sodium (2R)-1-methoxypropane-2-sulfinate |
| InChIKey | VYVNYWFMSBNESQ-PGMHMLKASA-M |
| SMILES | C[C@H](COC)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)