CAS 1638612-42-6 is the registry number for 1-(3-Fluorophenyl)-4-methoxy-6-oxo-1,6-dihydropyridazine-3-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(3-fluorophenyl)-4-methoxy-6-oxopyridazine-3-carboxylic acid (CAS 1638612-42-6) is a chemical compound with the molecular formula C12H9FN2O4 and a molecular weight of 264.21 g/mol. IUPAC name: 1-(3-fluorophenyl)-4-methoxy-6-oxopyridazine-3-carboxylic acid. InChIKey: CCXMXROKAZKXAP-UHFFFAOYSA-N.
| Molecular formula | C12H9FN2O4 |
|---|---|
| Molecular weight | 264.21 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-4-methoxy-6-oxopyridazine-3-carboxylic acid |
| InChIKey | CCXMXROKAZKXAP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=O)N(N=C1C(=O)O)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)