CAS 1638625-09-8 is the registry number for 2-methoxy-4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-methoxy-4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 1638625-09-8) is a chemical compound with the molecular formula C14H21BO4 and a molecular weight of 264.13 g/mol. IUPAC name: 2-methoxy-4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: BTHPLIQTCXENNG-UHFFFAOYSA-N.
| Molecular formula | C14H21BO4 |
|---|---|
| Molecular weight | 264.13 g/mol |
| IUPAC name | 2-methoxy-4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | BTHPLIQTCXENNG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2O)OC)C |
Computed by PubChem (NCBI)