CAS 1638647-55-8 is the registry number for 4,4'-((2,5-Dibromo-1,4-phenylene)bis(methoxymethylene))bis(tert-butylbenzene), 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
1,4-dibromo-2,5-bis[(4-tert-butylphenyl)-methoxymethyl]benzene (CAS 1638647-55-8) is a chemical compound with the molecular formula C30H36Br2O2 and a molecular weight of 588.4 g/mol. IUPAC name: 1,4-dibromo-2,5-bis[(4-tert-butylphenyl)-methoxymethyl]benzene. InChIKey: OSDPFNBMQODAQK-UHFFFAOYSA-N.
| Molecular formula | C30H36Br2O2 |
|---|---|
| Molecular weight | 588.4 g/mol |
| IUPAC name | 1,4-dibromo-2,5-bis[(4-tert-butylphenyl)-methoxymethyl]benzene |
| InChIKey | OSDPFNBMQODAQK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(C2=CC(=C(C=C2Br)C(C3=CC=C(C=C3)C(C)(C)C)OC)Br)OC |
Computed by PubChem (NCBI)