Products 1638736-04-5
CAS 1638736-04-5 is the registry number for 2,4-Diamino-6-hydroxypyrimidine-15N3. Offered by: TRC. Available pack sizes: 25mg.
4-amino-2-(15N)azanyl-(1,3-15N2)1H-pyrimidin-6-one (CAS 1638736-04-5) is a chemical compound with the molecular formula C4H6N4O and a molecular weight of 129.10 g/mol. IUPAC name: 4-amino-2-(15N)azanyl-(1,3-15N2)1H-pyrimidin-6-one. InChIKey: SWELIMKTDYHAOY-TTXLGWKISA-N.
| Molecular formula | C4H6N4O |
|---|---|
| Molecular weight | 129.10 g/mol |
| IUPAC name | 4-amino-2-(15N)azanyl-(1,3-15N2)1H-pyrimidin-6-one |
| InChIKey | SWELIMKTDYHAOY-TTXLGWKISA-N |
| SMILES | C1=C([15N]=C([15NH]C1=O)[15NH2])N |
Computed by PubChem (NCBI)