CAS 1638744-19-0 is the registry number for (3S,5R)-5-Methylpiperidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
(3S,5R)-5-methylpiperidine-3-carboxylic acid (CAS 1638744-19-0) is a chemical compound with the molecular formula C7H13NO2 and a molecular weight of 143.18 g/mol. IUPAC name: (3S,5R)-5-methylpiperidine-3-carboxylic acid. InChIKey: CBDSIHCOUDRMMA-RITPCOANSA-N.
| Molecular formula | C7H13NO2 |
|---|---|
| Molecular weight | 143.18 g/mol |
| IUPAC name | (3S,5R)-5-methylpiperidine-3-carboxylic acid |
| InChIKey | CBDSIHCOUDRMMA-RITPCOANSA-N |
| SMILES | C[C@@H]1C[C@@H](CNC1)C(=O)O |
Computed by PubChem (NCBI)