Products 1638744-68-9
CAS 1638744-68-9 is the registry number for (R)-7-Iodo-1,2,3,11a-tetrahydro-5H-benzo[e]pyrrolo[1,2-a][1,4]diazepin-5-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-iodo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (CAS 1638744-68-9) is a chemical compound with the molecular formula C12H11IN2O and a molecular weight of 326.13 g/mol. IUPAC name: 2-iodo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one. InChIKey: PAFKBTMDRDFEFL-UHFFFAOYSA-N.
| Molecular formula | C12H11IN2O |
|---|---|
| Molecular weight | 326.13 g/mol |
| IUPAC name | 2-iodo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| InChIKey | PAFKBTMDRDFEFL-UHFFFAOYSA-N |
| SMILES | C1CC2C=NC3=C(C=C(C=C3)I)C(=O)N2C1 |
Computed by PubChem (NCBI)