CAS 1638760-45-8 is the registry number for 5-Iodo-7-methyl-7h-pyrrolo[2,3-d]pyrimidine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
5-iodo-7-methylpyrrolo[2,3-d]pyrimidine-2-carboxylic acid (CAS 1638760-45-8) is a chemical compound with the molecular formula C8H6IN3O2 and a molecular weight of 303.06 g/mol. IUPAC name: 5-iodo-7-methylpyrrolo[2,3-d]pyrimidine-2-carboxylic acid. InChIKey: XVJQTBVWLVPNEY-UHFFFAOYSA-N.
| Molecular formula | C8H6IN3O2 |
|---|---|
| Molecular weight | 303.06 g/mol |
| IUPAC name | 5-iodo-7-methylpyrrolo[2,3-d]pyrimidine-2-carboxylic acid |
| InChIKey | XVJQTBVWLVPNEY-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CN=C(N=C21)C(=O)O)I |
Computed by PubChem (NCBI)