CAS 1638760-67-4 appears in our catalog under these names: 2-Chloro-6-iodo-7-(phenylsulfonyl)-7h-pyrrolo[2,3-d]pyrimidine, 95%, 2-Chloro-6-iodo-7-(phenylsulfonyl)-7H-pyrrolo(2,3-d)pyrimidine, 98%, 2-Chloro-6-iodo-7-(phenylsulfonyl)-7H-pyrrolo[2,3-d]pyrimidine, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 10g, 100mg, 250mg, 500mg.
7-(benzenesulfonyl)-2-chloro-6-iodopyrrolo[2,3-d]pyrimidine (CAS 1638760-67-4) is a chemical compound with the molecular formula C12H7ClIN3O2S and a molecular weight of 419.63 g/mol. IUPAC name: 7-(benzenesulfonyl)-2-chloro-6-iodopyrrolo[2,3-d]pyrimidine. InChIKey: DEEWPNAEVIKCNE-UHFFFAOYSA-N.
| Molecular formula | C12H7ClIN3O2S |
|---|---|
| Molecular weight | 419.63 g/mol |
| IUPAC name | 7-(benzenesulfonyl)-2-chloro-6-iodopyrrolo[2,3-d]pyrimidine |
| InChIKey | DEEWPNAEVIKCNE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C(=CC3=CN=C(N=C32)Cl)I |
Computed by PubChem (NCBI)