CAS 1638763-42-4 appears in our catalog under these names: 2,4-Dichloro-6-iodo-7-methyl-7h-pyrrolo[2,3-d]pyrimidine, 95%, 2,4-Dichloro-6-iodo-7-methyl-7H-pyrrolo(2,3-d)pyrimidine, 97%, 2,4-dichloro-6-iodo-7-methyl-7H-pyrrolo[2,3-d]pyrimidine, 97%, 97%, 2,4-DICHLORO-6-IODO-7-METHYL-7H-PYRROLO[2,3-D]PYRIMIDINE, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg, 500mg.
2,4-dichloro-6-iodo-7-methylpyrrolo[2,3-d]pyrimidine (CAS 1638763-42-4) is a chemical compound with the molecular formula C7H4Cl2IN3 and a molecular weight of 327.93 g/mol. IUPAC name: 2,4-dichloro-6-iodo-7-methylpyrrolo[2,3-d]pyrimidine. InChIKey: CKQREJUSPJUIPH-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2IN3 |
|---|---|
| Molecular weight | 327.93 g/mol |
| IUPAC name | 2,4-dichloro-6-iodo-7-methylpyrrolo[2,3-d]pyrimidine |
| InChIKey | CKQREJUSPJUIPH-UHFFFAOYSA-N |
| SMILES | CN1C(=CC2=C1N=C(N=C2Cl)Cl)I |
Computed by PubChem (NCBI)