CAS 1638763-86-6 appears in our catalog under these names: 2,4-Dichloro-6-iodo-7-(phenylsulfonyl)-7H-pyrrolo[2,3-d]pyrimidine, 97%, 2,4-Dichloro-6-iodo-7-(phenylsulfonyl)-7H-pyrrolo(2,3-d)pyrimidine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
7-(benzenesulfonyl)-2,4-dichloro-6-iodopyrrolo[2,3-d]pyrimidine (CAS 1638763-86-6) is a chemical compound with the molecular formula C12H6Cl2IN3O2S and a molecular weight of 454.1 g/mol. IUPAC name: 7-(benzenesulfonyl)-2,4-dichloro-6-iodopyrrolo[2,3-d]pyrimidine. InChIKey: YEJJZEVUTAQROE-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2IN3O2S |
|---|---|
| Molecular weight | 454.1 g/mol |
| IUPAC name | 7-(benzenesulfonyl)-2,4-dichloro-6-iodopyrrolo[2,3-d]pyrimidine |
| InChIKey | YEJJZEVUTAQROE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C(=CC3=C2N=C(N=C3Cl)Cl)I |
Computed by PubChem (NCBI)