CAS 1638920-50-9 is the registry number for Rel-(4S,5S)-5-fluoro-3,3-dimethylpiperidin-4-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S,5S)-5-fluoro-3,3-dimethylpiperidin-4-ol (CAS 1638920-50-9) is a chemical compound with the molecular formula C7H14FNO and a molecular weight of 147.19 g/mol. IUPAC name: (4S,5S)-5-fluoro-3,3-dimethylpiperidin-4-ol. InChIKey: JETLXIXZJFCRIB-NTSWFWBYSA-N.
| Molecular formula | C7H14FNO |
|---|---|
| Molecular weight | 147.19 g/mol |
| IUPAC name | (4S,5S)-5-fluoro-3,3-dimethylpiperidin-4-ol |
| InChIKey | JETLXIXZJFCRIB-NTSWFWBYSA-N |
| SMILES | CC1(CNC[C@@H]([C@H]1O)F)C |
Computed by PubChem (NCBI)