CAS 1638973-78-0 appears in our catalog under these names: Mitoebselen-2, MitoEbselen–2, MitoEbselen–2 chloride, MitoEbselen-2 (chloride), 97.0%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 250mg, 10mg, 100mg, 1g, 200mg, 25mg, 5mg, 50mg.
2-[[2-[4-(3-oxo-1,2-benzoselenazol-2-yl)phenyl]acetyl]amino]ethyl-triphenylphosphanium chloride (CAS 1638973-78-0) is a chemical compound with the molecular formula C35H30ClN2O2PSe and a molecular weight of 656.0 g/mol. IUPAC name: 2-[[2-[4-(3-oxo-1,2-benzoselenazol-2-yl)phenyl]acetyl]amino]ethyl-triphenylphosphanium chloride. InChIKey: RWZPPTYDYPSPOY-UHFFFAOYSA-N.
| Molecular formula | C35H30ClN2O2PSe |
|---|---|
| Molecular weight | 656.0 g/mol |
| IUPAC name | 2-[[2-[4-(3-oxo-1,2-benzoselenazol-2-yl)phenyl]acetyl]amino]ethyl-triphenylphosphanium chloride |
| InChIKey | RWZPPTYDYPSPOY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[P+](CCNC(=O)CC2=CC=C(C=C2)N3C(=O)C4=CC=CC=C4[Se]3)(C5=CC=CC=C5)C6=CC=CC=C6.[Cl-] |
Computed by PubChem (NCBI)