CAS 1639117-97-7 is the registry number for 6-Chloro-3-(difluoromethyl)-8-methyl-(1,2,4)triazolo(4,3-b)pyridazine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
6-chloro-3-(difluoromethyl)-8-methyl-[1,2,4]triazolo[4,3-b]pyridazine (CAS 1639117-97-7) is a chemical compound with the molecular formula C7H5ClF2N4 and a molecular weight of 218.59 g/mol. IUPAC name: 6-chloro-3-(difluoromethyl)-8-methyl-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: ULUPGAZPIXCMSI-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF2N4 |
|---|---|
| Molecular weight | 218.59 g/mol |
| IUPAC name | 6-chloro-3-(difluoromethyl)-8-methyl-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | ULUPGAZPIXCMSI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN2C1=NN=C2C(F)F)Cl |
Computed by PubChem (NCBI)