CAS 1639137-80-6 appears in our catalog under these names: Axitinib Impurity 27, N-Acetyl Axitinib, >95% (HPLC), (E)-2-((1-Acetyl-3-(2-(pyridin-2-yl)vinyl)-1H-indazol-6-yl)thio)-N-methylbenzamide (Axitinib Impurity), 97%. Offered by: Chemat Brand, TRC, Fluorochem. Available pack sizes: on request, 10mg, 2,5mg, 25mg, 50mg.
2-[1-acetyl-3-[(E)-2-pyridin-2-ylethenyl]indazol-6-yl]sulfanyl-N-methylbenzamide (CAS 1639137-80-6) is a chemical compound with the molecular formula C24H20N4O2S and a molecular weight of 428.5 g/mol. IUPAC name: 2-[1-acetyl-3-[(E)-2-pyridin-2-ylethenyl]indazol-6-yl]sulfanyl-N-methylbenzamide. InChIKey: DPCLTPPDTUVUIL-JLHYYAGUSA-N.
| Molecular formula | C24H20N4O2S |
|---|---|
| Molecular weight | 428.5 g/mol |
| IUPAC name | 2-[1-acetyl-3-[(E)-2-pyridin-2-ylethenyl]indazol-6-yl]sulfanyl-N-methylbenzamide |
| InChIKey | DPCLTPPDTUVUIL-JLHYYAGUSA-N |
| SMILES | CC(=O)N1C2=C(C=CC(=C2)SC3=CC=CC=C3C(=O)NC)C(=N1)/C=C/C4=CC=CC=N4 |
Computed by PubChem (NCBI)