Products 1639211-22-5
CAS 1639211-22-5 is the registry number for 3,3′,3′′-[1,3,5-Benzenetriyltri-(1E)-2,1-ethenediyl]tris[pyridine], 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-[(E)-2-[3,5-bis[(E)-2-pyridin-3-ylethenyl]phenyl]ethenyl]pyridine (CAS 1639211-22-5) is a chemical compound with the molecular formula C27H21N3 and a molecular weight of 387.5 g/mol. IUPAC name: 3-[(E)-2-[3,5-bis[(E)-2-pyridin-3-ylethenyl]phenyl]ethenyl]pyridine. InChIKey: LKPCLWGXKVROLQ-SRDSWEMOSA-N.
| Molecular formula | C27H21N3 |
|---|---|
| Molecular weight | 387.5 g/mol |
| IUPAC name | 3-[(E)-2-[3,5-bis[(E)-2-pyridin-3-ylethenyl]phenyl]ethenyl]pyridine |
| InChIKey | LKPCLWGXKVROLQ-SRDSWEMOSA-N |
| SMILES | C1=CC(=CN=C1)/C=C/C2=CC(=CC(=C2)/C=C/C3=CN=CC=C3)/C=C/C4=CN=CC=C4 |
Computed by PubChem (NCBI)