Products 1445889-54-2
CAS 1445889-54-2 is the registry number for 2,4,6-tris(4-Vinylphenyl)-1,3,5-triazine, 97%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2,4,6-tris(4-ethenylphenyl)-1,3,5-triazine (CAS 1445889-54-2) is a chemical compound with the molecular formula C27H21N3 and a molecular weight of 387.5 g/mol. IUPAC name: 2,4,6-tris(4-ethenylphenyl)-1,3,5-triazine. InChIKey: KSTKHSMUTZXBGZ-UHFFFAOYSA-N.
| Molecular formula | C27H21N3 |
|---|---|
| Molecular weight | 387.5 g/mol |
| IUPAC name | 2,4,6-tris(4-ethenylphenyl)-1,3,5-triazine |
| InChIKey | KSTKHSMUTZXBGZ-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=C(C=C3)C=C)C4=CC=C(C=C4)C=C |
Computed by PubChem (NCBI)