Products 1639211-37-2
CAS 1639211-37-2 is the registry number for 1,3,5-BEnzenetricarboxaldehyde, 2,4,6-trihydroxy-, polymer with hydrazine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Hydrazine;2,4,6-trihydroxybenzene-1,3,5-tricarbaldehyde (CAS 1639211-37-2) is a chemical compound with the molecular formula C9H10N2O6 and a molecular weight of 242.19 g/mol. IUPAC name: hydrazine;2,4,6-trihydroxybenzene-1,3,5-tricarbaldehyde. InChIKey: VKOVWBBAJIIULR-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O6 |
|---|---|
| Molecular weight | 242.19 g/mol |
| IUPAC name | hydrazine;2,4,6-trihydroxybenzene-1,3,5-tricarbaldehyde |
| InChIKey | VKOVWBBAJIIULR-UHFFFAOYSA-N |
| SMILES | C(=O)C1=C(C(=C(C(=C1O)C=O)O)C=O)O.NN |
Computed by PubChem (NCBI)