CAS 519032-13-4 is the registry number for 2-Ethyl 4-methyl 5,6-dihydroxypyrimidine-2,4-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-O-ethyl 4-O-methyl 5-hydroxy-6-oxo-1H-pyrimidine-2,4-dicarboxylate (CAS 519032-13-4) is a chemical compound with the molecular formula C9H10N2O6 and a molecular weight of 242.19 g/mol. IUPAC name: 2-O-ethyl 4-O-methyl 5-hydroxy-6-oxo-1H-pyrimidine-2,4-dicarboxylate. InChIKey: OTCGLOYIDBJUNY-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O6 |
|---|---|
| Molecular weight | 242.19 g/mol |
| IUPAC name | 2-O-ethyl 4-O-methyl 5-hydroxy-6-oxo-1H-pyrimidine-2,4-dicarboxylate |
| InChIKey | OTCGLOYIDBJUNY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=C(C(=O)N1)O)C(=O)OC |
Computed by PubChem (NCBI)