Products 1639263-80-1
CAS 1639263-80-1 appears in our catalog under these names: Vortioxetine Impurity 25, Vortioxetine Impurity 3, Vortioxetine Sulfone, >95% (HPLC). Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 25mg, 2mg, 1mg, 5mg, 10mg.
1-[2-(2,4-dimethylphenyl)sulfonylphenyl]piperazine (CAS 1639263-80-1) is a chemical compound with the molecular formula C18H22N2O2S and a molecular weight of 330.4 g/mol. IUPAC name: 1-[2-(2,4-dimethylphenyl)sulfonylphenyl]piperazine. InChIKey: POPAWWWQMLKDAC-UHFFFAOYSA-N.
| Molecular formula | C18H22N2O2S |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 1-[2-(2,4-dimethylphenyl)sulfonylphenyl]piperazine |
| InChIKey | POPAWWWQMLKDAC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)C2=CC=CC=C2N3CCNCC3)C |
Computed by PubChem (NCBI)