CAS 1639301-16-8 is the registry number for (2R)-2-Deoxy-2-fluoro-2-methyl-alpha-D-erythro-pentofuranose 3,5-Dibenzoate. Offered by: TRC. Available pack sizes: 50mg.
[(2R,5S)-3-benzoyloxy-4-fluoro-5-hydroxy-4-methyloxolan-2-yl]methyl benzoate (CAS 1639301-16-8) is a chemical compound with the molecular formula C20H19FO6 and a molecular weight of 374.4 g/mol. IUPAC name: [(2R,5S)-3-benzoyloxy-4-fluoro-5-hydroxy-4-methyloxolan-2-yl]methyl benzoate. InChIKey: KIGQNEVACHEDCP-GGYOGLCLSA-N.
| Molecular formula | C20H19FO6 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | [(2R,5S)-3-benzoyloxy-4-fluoro-5-hydroxy-4-methyloxolan-2-yl]methyl benzoate |
| InChIKey | KIGQNEVACHEDCP-GGYOGLCLSA-N |
| SMILES | CC1([C@H](O[C@@H](C1OC(=O)C2=CC=CC=C2)COC(=O)C3=CC=CC=C3)O)F |
Computed by PubChem (NCBI)