Products 1639426-14-4
CAS 1639426-14-4 is the registry number for Benquitrione, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: HPC Standards. Available pack sizes: 1x1ml.
3-(2,6-dimethylphenyl)-6-(2,6-dioxocyclohexanecarbonyl)-1-methylquinazoline-2,4-dione (CAS 1639426-14-4) is a chemical compound with the molecular formula C24H22N2O5 and a molecular weight of 418.4 g/mol. IUPAC name: 3-(2,6-dimethylphenyl)-6-(2,6-dioxocyclohexanecarbonyl)-1-methylquinazoline-2,4-dione. InChIKey: VIFAZRQTYOVSEU-UHFFFAOYSA-N.
| Molecular formula | C24H22N2O5 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | 3-(2,6-dimethylphenyl)-6-(2,6-dioxocyclohexanecarbonyl)-1-methylquinazoline-2,4-dione |
| InChIKey | VIFAZRQTYOVSEU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)N2C(=O)C3=C(C=CC(=C3)C(=O)C4C(=O)CCCC4=O)N(C2=O)C |
Computed by PubChem (NCBI)