Products 163958-73-4
CAS 163958-73-4 appears in our catalog under these names: TAPI 0, TAPI 0, TAPI-0, 98.98%, TAPI-0, 98%, Tapi-0 >= 95 % HPLC. Offered by: GLPBio, TargetMol, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 1 mg, 10 mg.
(2R)-N-[(2S)-1-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide (CAS 163958-73-4) is a chemical compound with the molecular formula C24H32N4O5 and a molecular weight of 456.5 g/mol. IUPAC name: (2R)-N-[(2S)-1-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide. InChIKey: CRCPLBFLOSEABN-BEVDRBHNSA-N.
| Molecular formula | C24H32N4O5 |
|---|---|
| Molecular weight | 456.5 g/mol |
| IUPAC name | (2R)-N-[(2S)-1-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide |
| InChIKey | CRCPLBFLOSEABN-BEVDRBHNSA-N |
| SMILES | C[C@@H](C(=O)N)NC(=O)[C@H](CC1=CC2=CC=CC=C2C=C1)NC(=O)[C@H](CC(C)C)CC(=O)NO |
Computed by PubChem (NCBI)