Products 16398-39-3
CAS 16398-39-3 is the registry number for Nitroxazepine (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[3-(dimethylamino)propyl]-8-nitrobenzo[b][1,4]benzoxazepin-6-one;hydrochloride (CAS 16398-39-3) is a chemical compound with the molecular formula C18H20ClN3O4 and a molecular weight of 377.8 g/mol. IUPAC name: 5-[3-(dimethylamino)propyl]-8-nitrobenzo[b][1,4]benzoxazepin-6-one;hydrochloride. InChIKey: QQYWZPWIDBROOG-UHFFFAOYSA-N.
| Molecular formula | C18H20ClN3O4 |
|---|---|
| Molecular weight | 377.8 g/mol |
| IUPAC name | 5-[3-(dimethylamino)propyl]-8-nitrobenzo[b][1,4]benzoxazepin-6-one;hydrochloride |
| InChIKey | QQYWZPWIDBROOG-UHFFFAOYSA-N |
| SMILES | CN(C)CCCN1C2=CC=CC=C2OC3=C(C1=O)C=C(C=C3)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)