CAS 1639843-35-8 is the registry number for Fmoc-L-Sec(Xan)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 25mg, 50mg, 100mg, 250mg, 500mg.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(9H-xanthen-9-ylselanyl)propanoic acid (CAS 1639843-35-8) is a chemical compound with the molecular formula C31H25NO5Se and a molecular weight of 570.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(9H-xanthen-9-ylselanyl)propanoic acid. InChIKey: PDQWNIOBRRROLD-SANMLTNESA-N.
| Molecular formula | C31H25NO5Se |
|---|---|
| Molecular weight | 570.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(9H-xanthen-9-ylselanyl)propanoic acid |
| InChIKey | PDQWNIOBRRROLD-SANMLTNESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](C[Se]C4C5=CC=CC=C5OC6=CC=CC=C46)C(=O)O |
Computed by PubChem (NCBI)