Products 1639924-58-5
CAS 1639924-58-5 appears in our catalog under these names: (2S，5R)–2，5–Dimethylmorpholine, (2S,5R)-2,5-Dimethylmorpholine, 98%, (2S,5R)-2,5-Dimethylmorpholine, 97%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 1g, 250mg, 5g.
(2S,5R)-2,5-dimethylmorpholine (CAS 1639924-58-5) is a chemical compound with the molecular formula C6H13NO and a molecular weight of 115.17 g/mol. IUPAC name: (2S,5R)-2,5-dimethylmorpholine. InChIKey: RPSYMAMREDJAES-RITPCOANSA-N.
| Molecular formula | C6H13NO |
|---|---|
| Molecular weight | 115.17 g/mol |
| IUPAC name | (2S,5R)-2,5-dimethylmorpholine |
| InChIKey | RPSYMAMREDJAES-RITPCOANSA-N |
| SMILES | C[C@H]1CN[C@@H](CO1)C |
Computed by PubChem (NCBI)
Synonyms:
(2S,5R)-2,5-dimethylmorpholine, morpholine, 2,5-dimethyl-, (2S,5R)-, InChI=1/C6H13NO/c1-5-4-8-6(2)3-7-5/h5-7H,3-4H2,1-2H3/t5-,6+/m1/s, trans-2,5-Dimethylmorpholine, (2S,5R)-2,5-dimethylmorpholin, 2,3-Pyridinediamine-3, 2,3-Diaminopyridine-d3, rac-(2r,5s)-2,5-dimethylmorpholine, s11084, (2S,5R)-2,5-Dimethyl-morpholine HCl