CAS 1639944-28-7 is the registry number for Rel-(4aR,8aR)-4a-methylhexahydro-1H-pyrido[3,4-b][1,4]oxazin-2(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4aR,8aR)-4a-methyl-1,5,6,7,8,8a-hexahydropyrido[3,4-b][1,4]oxazin-2-one (CAS 1639944-28-7) is a chemical compound with the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. IUPAC name: (4aR,8aR)-4a-methyl-1,5,6,7,8,8a-hexahydropyrido[3,4-b][1,4]oxazin-2-one. InChIKey: OJTRAOPOZDXADH-HTRCEHHLSA-N.
| Molecular formula | C8H14N2O2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | (4aR,8aR)-4a-methyl-1,5,6,7,8,8a-hexahydropyrido[3,4-b][1,4]oxazin-2-one |
| InChIKey | OJTRAOPOZDXADH-HTRCEHHLSA-N |
| SMILES | C[C@@]12CNCC[C@H]1NC(=O)CO2 |
Computed by PubChem (NCBI)