CAS 1639963-77-1 is the registry number for Di-tert-butyl 6-methyl-2,5,8-triazaspiro[3.5]nonane-2,8-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ditert-butyl 6-methyl-2,5,8-triazaspiro[3.5]nonane-2,8-dicarboxylate (CAS 1639963-77-1) is a chemical compound with the molecular formula C17H31N3O4 and a molecular weight of 341.4 g/mol. IUPAC name: ditert-butyl 6-methyl-2,5,8-triazaspiro[3.5]nonane-2,8-dicarboxylate. InChIKey: ZBNZKXWZZRLUCK-UHFFFAOYSA-N.
| Molecular formula | C17H31N3O4 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | ditert-butyl 6-methyl-2,5,8-triazaspiro[3.5]nonane-2,8-dicarboxylate |
| InChIKey | ZBNZKXWZZRLUCK-UHFFFAOYSA-N |
| SMILES | CC1CN(CC2(N1)CN(C2)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)