Products 1639972-90-9
CAS 1639972-90-9 is the registry number for ANT431. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(pyridin-3-ylsulfonylamino)-1,3-thiazole-4-carboxylic acid (CAS 1639972-90-9) is a chemical compound with the molecular formula C9H7N3O4S2 and a molecular weight of 285.3 g/mol. IUPAC name: 5-(pyridin-3-ylsulfonylamino)-1,3-thiazole-4-carboxylic acid. InChIKey: OLGRJQGVXXCIMN-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O4S2 |
|---|---|
| Molecular weight | 285.3 g/mol |
| IUPAC name | 5-(pyridin-3-ylsulfonylamino)-1,3-thiazole-4-carboxylic acid |
| InChIKey | OLGRJQGVXXCIMN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)S(=O)(=O)NC2=C(N=CS2)C(=O)O |
Computed by PubChem (NCBI)