CAS 1640118-52-0 appears in our catalog under these names: Alcohol c2f5-togni reagent, 95%, Alcohol C2F5-Togni reagent, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 500mg.
3,3-dimethyl-1-(1,1,2,2,2-pentafluoroethyl)-1lambda3,2-benziodoxole (CAS 1640118-52-0) is a chemical compound with the molecular formula C11H10F5IO and a molecular weight of 380.09 g/mol. IUPAC name: 3,3-dimethyl-1-(1,1,2,2,2-pentafluoroethyl)-1lambda3,2-benziodoxole. InChIKey: LCYUDGXZWNAFLM-UHFFFAOYSA-N.
| Molecular formula | C11H10F5IO |
|---|---|
| Molecular weight | 380.09 g/mol |
| IUPAC name | 3,3-dimethyl-1-(1,1,2,2,2-pentafluoroethyl)-1lambda3,2-benziodoxole |
| InChIKey | LCYUDGXZWNAFLM-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2I(O1)C(C(F)(F)F)(F)F)C |
Computed by PubChem (NCBI)