CAS 16404-16-3 appears in our catalog under these names: 2,6,8-Trichloro-7-Methyl Purine, 2,6,8-Trichloro-7-methyl-7H-purine. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 50mg, 0,5g.
2,6,8-trichloro-7-methylpurine (CAS 16404-16-3) is a chemical compound with the molecular formula C6H3Cl3N4 and a molecular weight of 237.5 g/mol. IUPAC name: 2,6,8-trichloro-7-methylpurine. InChIKey: UMASKSWPRALKCL-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl3N4 |
|---|---|
| Molecular weight | 237.5 g/mol |
| IUPAC name | 2,6,8-trichloro-7-methylpurine |
| InChIKey | UMASKSWPRALKCL-UHFFFAOYSA-N |
| SMILES | CN1C2=C(N=C(N=C2Cl)Cl)N=C1Cl |
Computed by PubChem (NCBI)