CAS 1640972-02-6 is the registry number for 6-Chloro-N-methyl Piperidinyl 4-Pyrimidinamine. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
N-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-6-chloro-N-methylpyrimidin-4-amine (CAS 1640972-02-6) is a chemical compound with the molecular formula C18H23ClN4 and a molecular weight of 330.9 g/mol. IUPAC name: N-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-6-chloro-N-methylpyrimidin-4-amine. InChIKey: VMBAGGQBDMFTSR-ZBFHGGJFSA-N.
| Molecular formula | C18H23ClN4 |
|---|---|
| Molecular weight | 330.9 g/mol |
| IUPAC name | N-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-6-chloro-N-methylpyrimidin-4-amine |
| InChIKey | VMBAGGQBDMFTSR-ZBFHGGJFSA-N |
| SMILES | C[C@@H]1CCN(C[C@@H]1N(C)C2=CC(=NC=N2)Cl)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)